C21H29ClN4O5S — CID 55311974
N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55311974) has the molecular formula C21H29ClN4O5S and a molecular weight of 485.01 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55311974 |
| Molecular Formula | C21H29ClN4O5S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C21H29ClN4O5S/c1-4-25(5-2)32(30,31)15-9-10-16(22)17(13-15)23-18(27)14-26-19(28)21(24(3)20(26)29)11-7-6-8-12-21/h9-10,13H,4-8,11-12,14H2,1-3H3,(H,23,27) |
| InChIKey | AOHJQYYEPYMVEY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|