C21H29N3O4 — CID 55887302
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-4-propan-2-yloxyphenyl)acetamide (PubChem CID 55887302) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-4-propan-2-yloxyphenyl)acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-4-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 55887302 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-4-propan-2-yloxyphenyl)acetamide |
| SMILES | Cc1cc(OC(C)C)ccc1NC(=O)CN1C(=O)N(C)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C21H29N3O4/c1-14(2)28-16-8-9-17(15(3)12-16)22-18(25)13-24-19(26)21(23(4)20(24)27)10-6-5-7-11-21/h8-9,12,14H,5-7,10-11,13H2,1-4H3,(H,22,25) |
| InChIKey | XKAPBIXMEFEOAW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|