C22H29ClN4O4 — CID 55673171
2-chloro-N,N-diethyl-4-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzamide (PubChem CID 55673171) has the molecular formula C22H29ClN4O4 and a molecular weight of 448.95 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55673171 |
| Molecular Formula | C22H29ClN4O4 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)cc1Cl |
| InChI | InChI=1S/C22H29ClN4O4/c1-4-26(5-2)19(29)16-10-9-15(13-17(16)23)24-18(28)14-27-20(30)22(25(3)21(27)31)11-7-6-8-12-22/h9-10,13H,4-8,11-12,14H2,1-3H3,(H,24,28) |
| InChIKey | FZPHPJMMHMKFOX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|