C18H21FN4O4 — CID 7850118
N-[(2-fluorophenyl)carbamoyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 7850118) has the molecular formula C18H21FN4O4 and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[(2-fluorophenyl)carbamoyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[(2-fluorophenyl)carbamoyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 7850118 |
| Molecular Formula | C18H21FN4O4 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[(2-fluorophenyl)carbamoyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CN1C(=O)N(CC(=O)NC(=O)Nc2ccccc2F)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C18H21FN4O4/c1-22-17(27)23(15(25)18(22)9-5-2-6-10-18)11-14(24)21-16(26)20-13-8-4-3-7-12(13)19/h3-4,7-8H,2,5-6,9-11H2,1H3,(H2,20,21,24,26) |
| InChIKey | YZUQRTCYOQVTEE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|