C25H28N4O3 — CID 38749385
N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 38749385) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 38749385 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2ccccc2N2CCc3ccccc32)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C25H28N4O3/c1-27-24(32)29(23(31)25(27)14-7-2-8-15-25)17-22(30)26-19-10-4-6-12-21(19)28-16-13-18-9-3-5-11-20(18)28/h3-6,9-12H,2,7-8,13-17H2,1H3,(H,26,30) |
| InChIKey | JEYVXJICBBUDOU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|