C16H20N4O4S — CID 9264394
2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]thiophene-3-carboxamide (PubChem CID 9264394) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 9264394 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]thiophene-3-carboxamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2sccc2C(N)=O)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C16H20N4O4S/c1-19-15(24)20(14(23)16(19)6-3-2-4-7-16)9-11(21)18-13-10(12(17)22)5-8-25-13/h5,8H,2-4,6-7,9H2,1H3,(H2,17,22)(H,18,21) |
| InChIKey | OBFIWZUHVUDKEA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|