C20H27N5O4 — CID 18228988
2-(4-methylanilino)-N'-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]acetohydrazide (PubChem CID 18228988) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-(4-methylanilino)-N'-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]acetohydrazide.
| Compound Name | 2-(4-methylanilino)-N'-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 18228988 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 2-(4-methylanilino)-N'-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C20H27N5O4/c1-14-6-8-15(9-7-14)21-12-16(26)22-23-17(27)13-25-18(28)20(24(2)19(25)29)10-4-3-5-11-20/h6-9,21H,3-5,10-13H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | OVIJADCZSAWAOR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|