C20H27N5O4 — CID 55377513
4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N'-[2-(4-methylanilino)acetyl]butanehydrazide (PubChem CID 55377513) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N'-[2-(4-methylanilino)acetyl]butanehydrazide.
| Compound Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N'-[2-(4-methylanilino)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 55377513 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N'-[2-(4-methylanilino)acetyl]butanehydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CCCN2C(=O)NC3(CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C20H27N5O4/c1-14-6-8-15(9-7-14)21-13-17(27)24-23-16(26)5-4-12-25-18(28)20(22-19(25)29)10-2-3-11-20/h6-9,21H,2-5,10-13H2,1H3,(H,22,29)(H,23,26)(H,24,27) |
| InChIKey | GQBDJXAWQRYDPV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|