C19H22N4O4 — CID 17413483
4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1,3-benzoxazol-5-yl)butanamide (PubChem CID 17413483) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1,3-benzoxazol-5-yl)butanamide.
| Compound Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1,3-benzoxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 17413483 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1,3-benzoxazol-5-yl)butanamide |
| SMILES | Cc1nc2cc(NC(=O)CCCN3C(=O)NC4(CCCC4)C3=O)ccc2o1 |
| InChI | InChI=1S/C19H22N4O4/c1-12-20-14-11-13(6-7-15(14)27-12)21-16(24)5-4-10-23-17(25)19(22-18(23)26)8-2-3-9-19/h6-7,11H,2-5,8-10H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | HYFPDDUQIODRQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|