C19H22N4O4 — CID 9450990
N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 9450990) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 9450990 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | Cc1nc2cc(NC(=O)CN3C(=O)N[C@]4(CCCC[C@@H]4C)C3=O)ccc2o1 |
| InChI | InChI=1S/C19H22N4O4/c1-11-5-3-4-8-19(11)17(25)23(18(26)22-19)10-16(24)21-13-6-7-15-14(9-13)20-12(2)27-15/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,21,24)(H,22,26)/t11-,19-/m0/s1 |
| InChIKey | ZHCPOPWQIMZEIT-WLRWDXFRSA-N |
| XLogP | 2.58 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|