C18H20N4O3 — CID 166280199
4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-7-ylbutanamide (PubChem CID 166280199) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-7-ylbutanamide.
| Compound Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-7-ylbutanamide |
|---|---|
| PubChem CID | 166280199 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-7-ylbutanamide |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)Nc2ccc3cccnc3c2)C1=O |
| InChI | InChI=1S/C18H20N4O3/c1-18(2)16(24)22(17(25)21-18)10-4-6-15(23)20-13-8-7-12-5-3-9-19-14(12)11-13/h3,5,7-9,11H,4,6,10H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | KZAQNEMITUMPRO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|