C18H22Cl2N4O4 — CID 24515219
N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide (PubChem CID 24515219) has the molecular formula C18H22Cl2N4O4 and a molecular weight of 429.30 g/mol. Its IUPAC name is N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide.
| Compound Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 24515219 |
| Molecular Formula | C18H22Cl2N4O4 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)CCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C18H22Cl2N4O4/c1-18(2)16(27)24(17(28)22-18)8-4-5-15(26)23(3)10-14(25)21-11-6-7-12(19)13(20)9-11/h6-7,9H,4-5,8,10H2,1-3H3,(H,21,25)(H,22,28) |
| InChIKey | DPCYMEADGABYIV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|