C17H23ClN4O3 — CID 60509196
N-(3-chlorophenyl)-2-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methylamino]acetamide (PubChem CID 60509196) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methylamino]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methylamino]acetamide |
|---|---|
| PubChem CID | 60509196 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(3-chlorophenyl)-2-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methylamino]acetamide |
| SMILES | CN(CCCN1C(=O)NC(C)(C)C1=O)CC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClN4O3/c1-17(2)15(24)22(16(25)20-17)9-5-8-21(3)11-14(23)19-13-7-4-6-12(18)10-13/h4,6-7,10H,5,8-9,11H2,1-3H3,(H,19,23)(H,20,25) |
| InChIKey | JNXGETHOXAAHOD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|