C15H15Cl2N3O5 — CID 7993697
[2-(3,4-dichloroanilino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7993697) has the molecular formula C15H15Cl2N3O5 and a molecular weight of 388.21 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7993697 |
| Molecular Formula | C15H15Cl2N3O5 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H15Cl2N3O5/c1-15(2)13(23)20(14(24)19-15)6-12(22)25-7-11(21)18-8-3-4-9(16)10(17)5-8/h3-5H,6-7H2,1-2H3,(H,18,21)(H,19,24) |
| InChIKey | CHHWKYZLUUWXGZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|