C16H18ClN3O5 — CID 8656733
[2-(4-chloroanilino)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 8656733) has the molecular formula C16H18ClN3O5 and a molecular weight of 367.79 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 8656733 |
| Molecular Formula | C16H18ClN3O5 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | CC1(C)NC(=O)N(CCC(=O)OCC(=O)Nc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C16H18ClN3O5/c1-16(2)14(23)20(15(24)19-16)8-7-13(22)25-9-12(21)18-11-5-3-10(17)4-6-11/h3-6H,7-9H2,1-2H3,(H,18,21)(H,19,24) |
| InChIKey | ILPJRXRKHCIVHQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|