C17H18F3N3O5 — CID 8656704
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 8656704) has the molecular formula C17H18F3N3O5 and a molecular weight of 401.34 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 8656704 |
| Molecular Formula | C17H18F3N3O5 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | CC1(C)NC(=O)N(CCC(=O)OCC(=O)Nc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C17H18F3N3O5/c1-16(2)14(26)23(15(27)22-16)8-7-13(25)28-9-12(24)21-11-5-3-10(4-6-11)17(18,19)20/h3-6H,7-9H2,1-2H3,(H,21,24)(H,22,27) |
| InChIKey | WLDMJLJZTZFWOT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|