C12H16F3N3O5 — CID 8657693
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 8657693) has the molecular formula C12H16F3N3O5 and a molecular weight of 339.27 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 8657693 |
| Molecular Formula | C12H16F3N3O5 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | CC1(C)NC(=O)N(CCC(=O)OCC(=O)NCC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H16F3N3O5/c1-11(2)9(21)18(10(22)17-11)4-3-8(20)23-5-7(19)16-6-12(13,14)15/h3-6H2,1-2H3,(H,16,19)(H,17,22) |
| InChIKey | SXEXXNSQLOQEGF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|