C11H18N2O4 — CID 112722968
propan-2-yl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 112722968) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is propan-2-yl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | propan-2-yl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 112722968 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | propan-2-yl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | CC(C)OC(=O)CCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C11H18N2O4/c1-7(2)17-8(14)5-6-13-9(15)11(3,4)12-10(13)16/h7H,5-6H2,1-4H3,(H,12,16) |
| InChIKey | BAURQURRSPXJAE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|