C16H21N3O3 — CID 40795155
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1R)-1-phenylethyl]propanamide (PubChem CID 40795155) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1R)-1-phenylethyl]propanamide.
| Compound Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1R)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 40795155 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1R)-1-phenylethyl]propanamide |
| SMILES | C[C@@H](NC(=O)CCN1C(=O)NC(C)(C)C1=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N3O3/c1-11(12-7-5-4-6-8-12)17-13(20)9-10-19-14(21)16(2,3)18-15(19)22/h4-8,11H,9-10H2,1-3H3,(H,17,20)(H,18,22)/t11-/m1/s1 |
| InChIKey | OZCBEPXMJPFLPY-LLVKDONJSA-N |
| XLogP | 1.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|