C25H22N2O3 — CID 42896543
3-(1,3-dioxoisoindol-2-yl)-N-[1-(4-phenylphenyl)ethyl]propanamide (PubChem CID 42896543) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[1-(4-phenylphenyl)ethyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[1-(4-phenylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 42896543 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[1-(4-phenylphenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCN1C(=O)c2ccccc2C1=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-17(18-11-13-20(14-12-18)19-7-3-2-4-8-19)26-23(28)15-16-27-24(29)21-9-5-6-10-22(21)25(27)30/h2-14,17H,15-16H2,1H3,(H,26,28) |
| InChIKey | HFYZZPVYAGYFAH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|