C31H26N2O3 — CID 45146224
3-(1,3-dioxoisoindol-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]propanamide (PubChem CID 45146224) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 45146224 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-phenyl-1-(4-phenylphenyl)ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NC(Cc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2O3/c34-29(19-20-33-30(35)26-13-7-8-14-27(26)31(33)36)32-28(21-22-9-3-1-4-10-22)25-17-15-24(16-18-25)23-11-5-2-6-12-23/h1-18,28H,19-21H2,(H,32,34) |
| InChIKey | ALGTUIWNZMJOLF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|