C25H21N3O4 — CID 23993693
N-(benzhydrylcarbamoyl)-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 23993693) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-(benzhydrylcarbamoyl)-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(benzhydrylcarbamoyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 23993693 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-(benzhydrylcarbamoyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O4/c29-21(15-16-28-23(30)19-13-7-8-14-20(19)24(28)31)26-25(32)27-22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,22H,15-16H2,(H2,26,27,29,32) |
| InChIKey | ZYPSZOORDULQKT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|