C20H19N3O3S — CID 19189100
3-(1,3-dioxoisoindol-2-yl)-N-(1-phenylethylcarbamothioyl)propanamide (PubChem CID 19189100) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(1-phenylethylcarbamothioyl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(1-phenylethylcarbamothioyl)propanamide |
|---|---|
| PubChem CID | 19189100 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(1-phenylethylcarbamothioyl)propanamide |
| SMILES | CC(NC(=S)NC(=O)CCN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O3S/c1-13(14-7-3-2-4-8-14)21-20(27)22-17(24)11-12-23-18(25)15-9-5-6-10-16(15)19(23)26/h2-10,13H,11-12H2,1H3,(H2,21,22,24,27) |
| InChIKey | ZHCGJDSNEQZSDF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|