C22H21N3O5S — CID 19189097
propan-2-yl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]benzoate (PubChem CID 19189097) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is propan-2-yl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]benzoate.
| Compound Name | propan-2-yl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19189097 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | propan-2-yl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=S)NC(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H21N3O5S/c1-13(2)30-21(29)14-7-9-15(10-8-14)23-22(31)24-18(26)11-12-25-19(27)16-5-3-4-6-17(16)20(25)28/h3-10,13H,11-12H2,1-2H3,(H2,23,24,26,31) |
| InChIKey | WATNJCOOJLTWBG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|