C20H22N2O3S — CID 19187874
propan-2-yl 4-(3-phenylpropanoylcarbamothioylamino)benzoate (PubChem CID 19187874) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is propan-2-yl 4-(3-phenylpropanoylcarbamothioylamino)benzoate.
| Compound Name | propan-2-yl 4-(3-phenylpropanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19187874 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | propan-2-yl 4-(3-phenylpropanoylcarbamothioylamino)benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=S)NC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-14(2)25-19(24)16-9-11-17(12-10-16)21-20(26)22-18(23)13-8-15-6-4-3-5-7-15/h3-7,9-12,14H,8,13H2,1-2H3,(H2,21,22,23,26) |
| InChIKey | ADFMNZKRUCQIPY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|