C25H25N3O2S — CID 17233671
3-phenyl-N-[4-(3-phenylpropanoylcarbamothioylamino)phenyl]propanamide (PubChem CID 17233671) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 3-phenyl-N-[4-(3-phenylpropanoylcarbamothioylamino)phenyl]propanamide.
| Compound Name | 3-phenyl-N-[4-(3-phenylpropanoylcarbamothioylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 17233671 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3-phenyl-N-[4-(3-phenylpropanoylcarbamothioylamino)phenyl]propanamide |
| SMILES | O=C(CCc1ccccc1)NC(=S)Nc1ccc(NC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c29-23(17-11-19-7-3-1-4-8-19)26-21-13-15-22(16-14-21)27-25(31)28-24(30)18-12-20-9-5-2-6-10-20/h1-10,13-16H,11-12,17-18H2,(H,26,29)(H2,27,28,30,31) |
| InChIKey | ITPTUEUPFKRRDJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|