C21H25N3OS — CID 1302092
3-phenyl-N-[(4-piperidin-1-ylphenyl)carbamothioyl]propanamide (PubChem CID 1302092) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 3-phenyl-N-[(4-piperidin-1-ylphenyl)carbamothioyl]propanamide.
| Compound Name | 3-phenyl-N-[(4-piperidin-1-ylphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 1302092 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3-phenyl-N-[(4-piperidin-1-ylphenyl)carbamothioyl]propanamide |
| SMILES | O=C(CCc1ccccc1)NC(=S)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25N3OS/c25-20(14-9-17-7-3-1-4-8-17)23-21(26)22-18-10-12-19(13-11-18)24-15-5-2-6-16-24/h1,3-4,7-8,10-13H,2,5-6,9,14-16H2,(H2,22,23,25,26) |
| InChIKey | ADMRJELGGYLBFZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|