C22H25N3O2S — CID 26168674
3-phenyl-N-[[3-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide (PubChem CID 26168674) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-phenyl-N-[[3-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide.
| Compound Name | 3-phenyl-N-[[3-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 26168674 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-phenyl-N-[[3-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide |
| SMILES | O=C(CCc1ccccc1)NC(=S)Nc1cccc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H25N3O2S/c26-20(13-12-17-8-3-1-4-9-17)24-22(28)23-19-11-7-10-18(16-19)21(27)25-14-5-2-6-15-25/h1,3-4,7-11,16H,2,5-6,12-15H2,(H2,23,24,26,28) |
| InChIKey | GXQBGTRUCOQVMW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|