C20H20ClN3O2S — CID 26162077
2-(4-chlorophenyl)-N-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]acetamide (PubChem CID 26162077) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 26162077 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=S)Nc1cccc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-16-8-6-14(7-9-16)12-18(25)23-20(27)22-17-5-3-4-15(13-17)19(26)24-10-1-2-11-24/h3-9,13H,1-2,10-12H2,(H2,22,23,25,27) |
| InChIKey | WLWUURYHFZWXKB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|