C23H25N3O2S — CID 26159883
(E)-N-[[3-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 26159883) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is (E)-N-[[3-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[3-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 26159883 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (E)-N-[[3-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)Nc1cccc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C23H25N3O2S/c27-21(14-13-18-9-4-3-5-10-18)25-23(29)24-20-12-8-11-19(17-20)22(28)26-15-6-1-2-7-16-26/h3-5,8-14,17H,1-2,6-7,15-16H2,(H2,24,25,27,29)/b14-13+ |
| InChIKey | PEIDGDRAHMOXDH-BUHFOSPRSA-N |
| XLogP | 4.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|