C26H31N3O4S — CID 55648219
N-[3-[4-(2-phenylethenylsulfonyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide (PubChem CID 55648219) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[3-[4-(2-phenylethenylsulfonyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[4-(2-phenylethenylsulfonyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55648219 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[3-[4-(2-phenylethenylsulfonyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCN(S(=O)(=O)C=Cc3ccccc3)CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H31N3O4S/c30-25(22-10-5-2-6-11-22)27-24-13-7-12-23(20-24)26(31)28-15-17-29(18-16-28)34(32,33)19-14-21-8-3-1-4-9-21/h1,3-4,7-9,12-14,19-20,22H,2,5-6,10-11,15-18H2,(H,27,30) |
| InChIKey | DRSZUXDFDLOLGR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |