C24H32N4O5 — CID 55649623
N-[3-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide (PubChem CID 55649623) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[3-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55649623 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-[3-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazine-1-carbonyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCN(C(=O)C(=O)N3CCOCC3)CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H32N4O5/c29-21(18-5-2-1-3-6-18)25-20-8-4-7-19(17-20)22(30)26-9-11-27(12-10-26)23(31)24(32)28-13-15-33-16-14-28/h4,7-8,17-18H,1-3,5-6,9-16H2,(H,25,29) |
| InChIKey | IQNLXKNBGXDYHO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|