C17H23N3O3 — CID 51082716
1-cyclopentyl-3-[3-(morpholine-4-carbonyl)phenyl]urea (PubChem CID 51082716) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-(morpholine-4-carbonyl)phenyl]urea.
| Compound Name | 1-cyclopentyl-3-[3-(morpholine-4-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 51082716 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-cyclopentyl-3-[3-(morpholine-4-carbonyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(=O)N2CCOCC2)c1)NC1CCCC1 |
| InChI | InChI=1S/C17H23N3O3/c21-16(20-8-10-23-11-9-20)13-4-3-7-15(12-13)19-17(22)18-14-5-1-2-6-14/h3-4,7,12,14H,1-2,5-6,8-11H2,(H2,18,19,22) |
| InChIKey | PTGOGZZFIKYAOX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |