C22H29N3O5 — CID 43074897
N-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]oxolane-2-carboxamide (PubChem CID 43074897) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 43074897 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCC(C(=O)N3CCOCC3)CC2)c1)C1CCCO1 |
| InChI | InChI=1S/C22H29N3O5/c26-20(19-5-2-12-30-19)23-18-4-1-3-17(15-18)22(28)24-8-6-16(7-9-24)21(27)25-10-13-29-14-11-25/h1,3-4,15-16,19H,2,5-14H2,(H,23,26) |
| InChIKey | SPOXTYKQYZMHLZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |