C20H23N3O3S2 — CID 2962070
3-phenyl-N-[(3-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]propanamide (PubChem CID 2962070) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 3-phenyl-N-[(3-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]propanamide.
| Compound Name | 3-phenyl-N-[(3-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 2962070 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-phenyl-N-[(3-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]propanamide |
| SMILES | O=C(CCc1ccccc1)NC(=S)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H23N3O3S2/c24-19(12-11-16-7-2-1-3-8-16)22-20(27)21-17-9-6-10-18(15-17)28(25,26)23-13-4-5-14-23/h1-3,6-10,15H,4-5,11-14H2,(H2,21,22,24,27) |
| InChIKey | ZRAZYBRGSLSOPP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|