C12H17N3O2S2 — CID 4086118
1-methyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 4086118) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-methyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-methyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 4086118 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-methyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | CNC(=S)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-13-12(18)14-10-5-4-6-11(9-10)19(16,17)15-7-2-3-8-15/h4-6,9H,2-3,7-8H2,1H3,(H2,13,14,18) |
| InChIKey | QTHXUFMUWYEKOF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|