C14H21N3O2S2 — CID 7941210
1-methyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea (PubChem CID 7941210) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-methyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-methyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 7941210 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-methyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea |
| SMILES | CNC(=S)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1C |
| InChI | InChI=1S/C14H21N3O2S2/c1-11-6-7-12(10-13(11)16-14(20)15-2)21(18,19)17-8-4-3-5-9-17/h6-7,10H,3-5,8-9H2,1-2H3,(H2,15,16,20) |
| InChIKey | GPUWQVPTCJBKNA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|