C20H26ClN3O3S — CID 120568671
N-(5-amino-2-methylphenyl)-2-methyl-5-piperidin-1-ylsulfonylbenzamide;hydrochloride (PubChem CID 120568671) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-2-methyl-5-piperidin-1-ylsulfonylbenzamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-2-methyl-5-piperidin-1-ylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120568671 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-2-methyl-5-piperidin-1-ylsulfonylbenzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1C.Cl |
| InChI | InChI=1S/C20H25N3O3S.ClH/c1-14-7-9-17(27(25,26)23-10-4-3-5-11-23)13-18(14)20(24)22-19-12-16(21)8-6-15(19)2;/h6-9,12-13H,3-5,10-11,21H2,1-2H3,(H,22,24);1H |
| InChIKey | YRRAGZONJZYFRV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|