C25H26N2O3S — CID 26727569
2-methyl-N-(2-phenylphenyl)-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 26727569) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-methyl-N-(2-phenylphenyl)-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-methyl-N-(2-phenylphenyl)-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26727569 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-methyl-N-(2-phenylphenyl)-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-19-14-15-21(31(29,30)27-16-8-3-9-17-27)18-23(19)25(28)26-24-13-7-6-12-22(24)20-10-4-2-5-11-20/h2,4-7,10-15,18H,3,8-9,16-17H2,1H3,(H,26,28) |
| InChIKey | UKSANGUTOYCQCT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |