C20H21F2N3O4S — CID 56570635
2,4-difluoro-5-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]benzamide (PubChem CID 56570635) has the molecular formula C20H21F2N3O4S and a molecular weight of 437.47 g/mol. Its IUPAC name is 2,4-difluoro-5-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]benzamide.
| Compound Name | 2,4-difluoro-5-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 56570635 |
| Molecular Formula | C20H21F2N3O4S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2,4-difluoro-5-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C20H21F2N3O4S/c1-12-5-6-13(30(28,29)25-7-3-2-4-8-25)9-14(12)20(27)24-18-10-15(19(23)26)16(21)11-17(18)22/h5-6,9-11H,2-4,7-8H2,1H3,(H2,23,26)(H,24,27) |
| InChIKey | JTDWIRYGUZQEIJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |