C20H25N3O2S2 — CID 3991323
1-benzyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea (PubChem CID 3991323) has the molecular formula C20H25N3O2S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-benzyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-benzyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 3991323 |
| Molecular Formula | C20H25N3O2S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-benzyl-3-(2-methyl-5-piperidin-1-ylsulfonylphenyl)thiourea |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O2S2/c1-16-10-11-18(27(24,25)23-12-6-3-7-13-23)14-19(16)22-20(26)21-15-17-8-4-2-5-9-17/h2,4-5,8-11,14H,3,6-7,12-13,15H2,1H3,(H2,21,22,26) |
| InChIKey | WUJUIEDRDFVEGL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|