C19H23N3O2S3 — CID 53489084
1-(3-methylsulfanylphenyl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea (PubChem CID 53489084) has the molecular formula C19H23N3O2S3 and a molecular weight of 421.61 g/mol. Its IUPAC name is 1-(3-methylsulfanylphenyl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(3-methylsulfanylphenyl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 53489084 |
| Molecular Formula | C19H23N3O2S3 |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-(3-methylsulfanylphenyl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea |
| SMILES | CSc1cccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C19H23N3O2S3/c1-26-17-7-5-6-16(14-17)21-19(25)20-15-8-10-18(11-9-15)27(23,24)22-12-3-2-4-13-22/h5-11,14H,2-4,12-13H2,1H3,(H2,20,21,25) |
| InChIKey | KWZLPNUDDXKJHO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|