C17H17ClFN3O2S2 — CID 23767543
1-(4-chloro-3-fluorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 23767543) has the molecular formula C17H17ClFN3O2S2 and a molecular weight of 413.93 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 23767543 |
| Molecular Formula | C17H17ClFN3O2S2 |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)Nc2ccc(Cl)c(F)c2)cc1)N1CCCC1 |
| InChI | InChI=1S/C17H17ClFN3O2S2/c18-15-8-5-13(11-16(15)19)21-17(25)20-12-3-6-14(7-4-12)26(23,24)22-9-1-2-10-22/h3-8,11H,1-2,9-10H2,(H2,20,21,25) |
| InChIKey | ASNCCKQHMIMSIM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|