C23H23N3O3S2 — CID 23959078
1-(4-phenoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 23959078) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(4-phenoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 23959078 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 1-(4-phenoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)Nc2ccc(Oc3ccccc3)cc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C23H23N3O3S2/c27-31(28,26-16-4-5-17-26)22-14-10-19(11-15-22)25-23(30)24-18-8-12-21(13-9-18)29-20-6-2-1-3-7-20/h1-3,6-15H,4-5,16-17H2,(H2,24,25,30) |
| InChIKey | KYZXCDQBZQVJGO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|