C28H31N3O5S2 — CID 4953019
N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 4953019) has the molecular formula C28H31N3O5S2 and a molecular weight of 553.71 g/mol. Its IUPAC name is N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4953019 |
| Molecular Formula | C28H31N3O5S2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N3O5S2/c32-27(22-10-14-25(15-11-22)36-21-20-35-24-8-4-3-5-9-24)30-28(37)29-23-12-16-26(17-13-23)38(33,34)31-18-6-1-2-7-19-31/h3-5,8-17H,1-2,6-7,18-21H2,(H2,29,30,32,37) |
| InChIKey | YLUXRXFILPDHCZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|