C29H27N3O5S2 — CID 4953078
N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 4953078) has the molecular formula C29H27N3O5S2 and a molecular weight of 561.69 g/mol. Its IUPAC name is N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4953078 |
| Molecular Formula | C29H27N3O5S2 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27N3O5S2/c33-28(23-11-15-26(16-12-23)37-20-19-36-25-9-5-2-6-10-25)32-29(38)31-24-13-17-27(18-14-24)39(34,35)30-21-22-7-3-1-4-8-22/h1-18,30H,19-21H2,(H2,31,32,33,38) |
| InChIKey | SITCXTMOGDTCTG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|