C21H17N5O7S2 — CID 4929027
N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 4929027) has the molecular formula C21H17N5O7S2 and a molecular weight of 515.53 g/mol. Its IUPAC name is N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4929027 |
| Molecular Formula | C21H17N5O7S2 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17N5O7S2/c27-20(15-10-17(25(28)29)12-18(11-15)26(30)31)24-21(34)23-16-6-8-19(9-7-16)35(32,33)22-13-14-4-2-1-3-5-14/h1-12,22H,13H2,(H2,23,24,27,34) |
| InChIKey | PBHHMYPPFWRCEE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 173.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|