C14H11N5O7S2 — CID 90654786
3,5-dinitro-N-[(3-sulfamoylphenyl)carbamothioyl]benzamide (PubChem CID 90654786) has the molecular formula C14H11N5O7S2 and a molecular weight of 425.40 g/mol. Its IUPAC name is 3,5-dinitro-N-[(3-sulfamoylphenyl)carbamothioyl]benzamide.
| Compound Name | 3,5-dinitro-N-[(3-sulfamoylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 90654786 |
| Molecular Formula | C14H11N5O7S2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | 3,5-dinitro-N-[(3-sulfamoylphenyl)carbamothioyl]benzamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=S)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C14H11N5O7S2/c15-28(25,26)12-3-1-2-9(6-12)16-14(27)17-13(20)8-4-10(18(21)22)7-11(5-8)19(23)24/h1-7H,(H2,15,25,26)(H2,16,17,20,27) |
| InChIKey | ZDTGLFZWPQNQRX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 187.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|