C14H8Cl2N4O5S — CID 3337452
N-[(3,4-dichlorophenyl)carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 3337452) has the molecular formula C14H8Cl2N4O5S and a molecular weight of 415.21 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[(3,4-dichlorophenyl)carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3337452 |
| Molecular Formula | C14H8Cl2N4O5S |
| Molecular Weight | 415.21 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | N-[(3,4-dichlorophenyl)carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)c(Cl)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8Cl2N4O5S/c15-11-2-1-8(5-12(11)16)17-14(26)18-13(21)7-3-9(19(22)23)6-10(4-7)20(24)25/h1-6H,(H2,17,18,21,26) |
| InChIKey | XAAOMDKAYBKVAU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|