C16H13ClN4O4S — CID 5153706
N-[(4-acetamidophenyl)carbamothioyl]-4-chloro-3-nitrobenzamide (PubChem CID 5153706) has the molecular formula C16H13ClN4O4S and a molecular weight of 392.82 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)carbamothioyl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[(4-acetamidophenyl)carbamothioyl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 5153706 |
| Molecular Formula | C16H13ClN4O4S |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-[(4-acetamidophenyl)carbamothioyl]-4-chloro-3-nitrobenzamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H13ClN4O4S/c1-9(22)18-11-3-5-12(6-4-11)19-16(26)20-15(23)10-2-7-13(17)14(8-10)21(24)25/h2-8H,1H3,(H,18,22)(H2,19,20,23,26) |
| InChIKey | BHLLQXQYPWPGLE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|